CAS 57194-70-4
:Neosenkirkine
Description:
Neosenkirkine, with the CAS number 57194-70-4, is a chemical compound that belongs to the class of alkaloids, which are naturally occurring organic compounds that mostly contain basic nitrogen atoms. Alkaloids are known for their diverse pharmacological properties and can be found in various plants. Neosenkirkine is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. While specific details about its solubility, stability, and reactivity may vary, compounds in this class often exhibit significant interactions with biological systems, potentially influencing neurotransmitter pathways or exhibiting anti-inflammatory properties. Research into neosenkirkine may focus on its potential therapeutic applications, mechanisms of action, and effects on human health. However, as with many alkaloids, the precise characteristics and effects of neosenkirkine require further investigation to fully understand its potential uses and safety profile.
Formula:C19H27NO6
InChI:InChI=1S/C19H27NO6/c1-5-13-10-12(2)19(3,24)18(23)25-11-14-6-8-20(4)9-7-15(16(14)21)26-17(13)22/h5-6,12,15,24H,7-11H2,1-4H3/b13-5+,14-6?/t12-,15-,19-/m1/s1
InChI key:InChIKey=HPDHKHMHQGCNPE-BBVWYNPTSA-N
SMILES:O=C1[C@@]2(OC(=O)\C(=C\C)\C[C@@H](C)[C@@](C)(O)C(=O)OCC1=CCN(C)CC2)[H]
Synonyms:- 4,8-Secosenecionan-8,11,16-trione, 12-hydroxy-4-methyl-, (15E)-
- Neosenkirkine
- 2,9-Dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione, 4-ethylidene-7-hydroxy-6,7,14-trimethyl-, [1R-(1R*,4E,6R*,7R*)]-
- 2,9-Dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione, 4-ethylidene-7-hydroxy-6,7,14-trimethyl-, (1R,4E,6R,7R)-
- (1R,4E,6R,7R)-4-Ethylidene-7-hydroxy-6,7,14-trimethyl-2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Neosenkirkine
CAS:Neosenkirkine is a useful organic compound for research related to life sciences. The catalog number is T124633 and the CAS number is 57194-70-4.Formula:C19H27NO6Color and Shape:SolidMolecular weight:365.426
