CymitQuimica logo

CAS 57196-61-9

:

4,6-dihydroxy-2-methyl-1,2,3,4-tetrahydroisoquinolinium chloride

Description:
4,6-Dihydroxy-2-methyl-1,2,3,4-tetrahydroisoquinolinium chloride is a chemical compound characterized by its tetrahydroisoquinoline structure, which includes a saturated bicyclic framework. This compound features two hydroxyl (-OH) groups at the 4 and 6 positions, contributing to its potential reactivity and solubility in polar solvents. The presence of a methyl group at the 2 position further influences its chemical properties and biological activity. As a quaternary ammonium salt, it contains a chloride ion, which enhances its solubility in water and other polar solvents. This compound may exhibit various biological activities, making it of interest in pharmacological research. Its structural features suggest potential interactions with biological systems, particularly in the context of neurochemistry, where isoquinoline derivatives are often studied for their effects on neurotransmitter systems. Overall, 4,6-dihydroxy-2-methyl-1,2,3,4-tetrahydroisoquinolinium chloride is a compound of interest in both synthetic and medicinal chemistry due to its unique structural characteristics and potential applications.
Formula:C10H14ClNO2
InChI:InChI=1/C10H13NO2.ClH/c1-11-5-7-2-3-8(12)4-9(7)10(13)6-11;/h2-4,10,12-13H,5-6H2,1H3;1H
SMILES:CN1Cc2ccc(cc2C(C1)O)O.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.