CAS 57198-02-4

1-[(2S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,2,4-triazole-3-carboxamide

Description:

The chemical substance known as 1-[(2S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,2,4-triazole-3-carboxamide, with the CAS number 57198-02-4, is a complex organic compound featuring a triazole ring and a sugar-like moiety. This compound is characterized by its structural components, which include a tetrahydrofuran ring substituted with hydroxyl groups, contributing to its potential solubility and reactivity. The presence of the triazole group suggests potential applications in medicinal chemistry, particularly as an antifungal or antiviral agent, due to the biological activity often associated with triazole derivatives. The carboxamide functional group may enhance its interaction with biological targets, influencing its pharmacokinetic properties. Additionally, the stereochemistry indicated by the (2S,4R,5R) configuration suggests specific spatial arrangements that could affect the compound's biological activity and binding affinity. Overall, this compound exemplifies the intersection of carbohydrate chemistry and heterocyclic chemistry, making it of interest in various fields, including pharmaceuticals and biochemistry.

Formula: C₈H₁₂N₄O₅

InChI: InChI=1/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4+,5?,8+/m1/s1

Ribavirin EP Impurity B

CAS: 57198-02-4

Formula: C₈H₁₂N₄O₅

Color and Shape: White To Off-White Solid

Molecular weight: 244.21

Ref: 4Z-R-049

a-Ribavirin (impurity B)

CAS: 57198-02-4

Ref: 7W-GN9445

α-Ribavirin (Ribavirin Impurity B)

Controlled Product

CAS: 57198-02-4

Formula: C₈H₁₂N₄O₅

Color and Shape: Neat

Molecular weight: 244.20

Ref: TR-R414470

a-Ribavirin (impurity B)

Controlled Product

CAS: 57198-02-4

Ribavirin is an antiviral drug that inhibits the synthesis of RNA and DNA. It is used to treat human immunodeficiency virus (HIV) infection, hepatitis B, and influenza A. Ribavirin is a nucleoside analog that acts as an antimetabolite by inhibiting acid synthesis in the host cell and therefore blocking viral replication. Ribavirin has been shown to inhibit dna viruses like herpes simplex virus type 1 and 2, as well as RNA viruses like influenza A and respiratory syncytial virus. Ribavirin also binds to the ribonucleotide reductase enzyme, which is necessary for the production of deoxyribonucleotides from ribonucleotides during DNA synthesis, thereby interfering with DNA replication.

Formula: C₈H₁₂N₄O₅

Purity: Min. 95%

Molecular weight: 244.2 g/mol

Ref: 3D-NR10396

Ribavirin EP Impurity B

CAS: 57198-02-4

Formula: C₈H₁₂N₄O₅

Molecular weight: 244.21

Ref: ST-EA-CP-R81002