CAS 572-32-7
:Ayanin
Description:
Ayanin, with the CAS number 572-32-7, is a chemical compound that belongs to the class of flavonoids, specifically a type of flavonol. It is primarily derived from various plant sources and is known for its potential antioxidant properties. Ayanin exhibits a characteristic yellow to orange color, which is typical of many flavonoids, and it is soluble in organic solvents but has limited solubility in water. This compound is often studied for its biological activities, including anti-inflammatory and antimicrobial effects, making it of interest in pharmacological research. Additionally, ayanin may contribute to the color and health benefits of certain fruits and vegetables, playing a role in plant defense mechanisms. Its structure features multiple hydroxyl groups, which are responsible for its reactivity and interaction with various biological systems. As with many natural compounds, further research is ongoing to fully elucidate its mechanisms of action and potential applications in health and nutrition.
Formula:C18H16O7
InChI:InChI=1S/C18H16O7/c1-22-10-7-12(20)15-14(8-10)25-17(18(24-3)16(15)21)9-4-5-13(23-2)11(19)6-9/h4-8,19-20H,1-3H3
InChI key:InChIKey=KPCRYSMUMBNTCK-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC=2C(C1=O)=C(O)C=C(OC)C2)C3=CC(O)=C(OC)C=C3
Synonyms:- 3',5-Dihydroxy-3,4',7-Trimethoxy-Flavone
- 3',5-Dihydroxy-3,4',7-trimethoxyflavone
- 3,4′,7-Trimethylquercetin
- 3,7,4'-Tri-O-methylquercetin
- 3,7,4′-Trimethylquercetin
- 4H-1-Benzopyran-4-one, 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7-dimethoxy-
- 5,3′-Dihydroxy-3,7,4′-trimethoxyflavone
- 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one
- 572-32-7
- Ayanin
- Ayarin
- Flavone, 3′,5-dihydroxy-3,4′,7-trimethoxy-
- NSC 691652
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ayanin
CAS:Ayanin: a vasorelaxant with potential in allergic asthma treatment; IL-4 inhibition IC50 of 2.2µM; non-selective PDE1-4 inhibitor for respiratory research.Formula:C18H16O7Purity:99.65%Color and Shape:SolidMolecular weight:344.32Quercetin 3,7,4'-trimethylether
CAS:Quercetin 3,7,4'-trimethylether is a flavonoid derivative, which is a naturally occurring compound. It is sourced from various plants where it acts as a secondary metabolite. Its mode of action involves the modulation of signaling pathways and the inhibition of certain enzymes. Specifically, it has demonstrated the ability to interfere with cellular processes fundamental to cancer progression, such as proliferation and apoptosis.
Formula:C18H16O7Purity:Min. 95%Molecular weight:344.32 g/mol





