CAS 572-60-1
:Epiquinine
Description:
Epiquinine, with the CAS number 572-60-1, is an alkaloid derived from the cinchona tree, known for its role as a stereoisomer of quinine. It is characterized by its bitter taste and is primarily recognized for its antimalarial properties, similar to its parent compound, quinine. Epiquinine exhibits a chiral structure, which contributes to its pharmacological activity. The compound is typically found in crystalline form and is soluble in alcohol and water, though its solubility can vary depending on the pH of the solution. Epiquinine has been studied for its potential therapeutic applications beyond malaria, including its effects on various biological systems. Its mechanism of action involves interference with the parasite's ability to metabolize hemoglobin, leading to its cytotoxic effects. Additionally, it has been investigated for its potential use in treating other conditions, such as nocturnal leg cramps. As with many alkaloids, caution is advised regarding its use due to possible side effects and toxicity at higher doses.
Formula:C20H24N2O2
InChI:InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19-,20-/m0/s1
InChI key:InChIKey=LOUPRKONTZGTKE-FEBSWUBLSA-N
SMILES:[C@H](O)(C=1C2=C(C=CC(OC)=C2)N=CC1)[C@]3([N@@]4C[C@H](C=C)[C@](C3)(CC4)[H])[H]
Synonyms:- (8alpha,9S)-6'-Methoxycinchonan-9-ol
- 9-Epiquinine
- 9-epi-Quinine
- Cinchonan-9-ol, 6'-methoxy-, (8alpha,9S)-
- Cinchonan-9-ol, 6′-methoxy-, (8α,9S)-
- Epiquinine
- (8α,9S)-6′-Methoxycinchonan-9-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
9-epi Quinine
CAS:Controlled ProductApplications The 9-epimer of Quinine (Q694000). Antimalarial.
References Muhtadi, F.J., et al.: Anal. Profiles Drug Subs., 12, 547 (1983), Kremsner, P.G., et al.: J. Infect. Dis., 169, 467 (1994),Formula:C20H24N2O2Color and Shape:NeatMolecular weight:324.42
