CAS 5721-37-9
:1-methylethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Description:
The chemical substance known as "1-methylethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate," with the CAS number 5721-37-9, is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a hexahydroquinoline core, which is a bicyclic structure known for its presence in various bioactive compounds. The presence of a bromo substituent and a methoxyphenyl group indicates potential reactivity and biological activity, making it of interest in medicinal chemistry. The ester functional group suggests that it may exhibit properties typical of esters, such as volatility and solubility in organic solvents. Additionally, the compound's intricate structure may contribute to its pharmacological properties, potentially influencing its interactions with biological targets. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in pharmaceuticals and other fields.
Formula:C19H21N
InChI:InChI=1/C28H28BrNO6/c1-14(2)36-28(32)25-15(3)30-21-9-17(16-5-7-18(33-4)8-6-16)10-22(31)27(21)26(25)19-11-23-24(12-20(19)29)35-13-34-23/h5-8,11-12,14,17,26,30H,9-10,13H2,1-4H3
SMILES:CC(C)OC(=O)C1=C(C)NC2=C(C(=O)CC(C2)c2ccc(cc2)OC)C1c1cc2c(cc1Br)OCO2
Synonyms:- 3-Quinolinecarboxylic Acid, 4-(6-Bromo-1,3-Benzodioxol-5-Yl)-1,4,5,6,7,8-Hexahydro-7-(4-Methoxyphenyl)-2-Methyl-5-Oxo-, 1-Methylethyl Ester
- Isopropyl 4-(6-bromo-1,3-benzodioxol-5-yl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
- 9,10-Ethanoanthracene-9(10H)-propanamine
- desmethylmaprotiline
- IFHUOEQJTQWFGJ-UHFFFAOYSA-N
- Normaprotiline
- 3-(9,10-Ethanoanthracen-9(10H)-yl)propan-1-amine
- 9,10-Ethanoanthracene-9(10H)-propan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Normaprotiline Hydrochloride
CAS:Controlled ProductFormula:C19H21NColor and Shape:NeatMolecular weight:263.38

