CAS 57212-58-5
:Pyridoxylideneisoleucinepotassiumsalt
Description:
Pyridoxylideneisoleucine potassium salt, identified by the CAS number 57212-58-5, is a chemical compound that serves as a derivative of pyridoxine (vitamin B6) and is involved in various biochemical processes. This compound typically exhibits characteristics associated with amino acids and their derivatives, including solubility in water due to the presence of ionic groups, which enhances its bioavailability. It may play a role in metabolic pathways, particularly in amino acid metabolism and neurotransmitter synthesis. The potassium salt form suggests that it can dissociate in solution, releasing potassium ions, which are essential for numerous physiological functions, including nerve transmission and muscle contraction. The compound's stability, reactivity, and specific applications can vary based on its structural features and the presence of functional groups. As with many biochemical substances, its efficacy and safety profile would depend on concentration and context of use, particularly in nutritional or therapeutic applications. Further research may be necessary to fully elucidate its properties and potential benefits.
Formula:C14H19KN2O4
InChI:InChI=1/C14H20N2O4.K/c1-4-8(2)12(14(19)20)16-6-11-10(7-17)5-15-9(3)13(11)18;/h5-6,8,12,17-18H,4,7H2,1-3H3,(H,19,20);/q;+1/p-1/b16-6+;/t8-,12-;/m0./s1
SMILES:CCC(C)C(C(=O)O)N=Cc1c(cnc(C)c1O)CO.K
Synonyms:- Pyridoxylidene-L-isoleucine potassium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
