CAS 57235-35-5

4,6-Dimethoxy-2-Mercaptopyrimidine

Description:

4,6-Dimethoxy-2-mercaptopyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of two methoxy groups at positions 4 and 6 contributes to its chemical properties, enhancing its solubility and reactivity. The thiol group (-SH) at position 2 imparts significant nucleophilicity, making it a potential candidate for various chemical reactions, including those involving electrophiles. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its unique structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in agricultural chemistry for the synthesis of agrochemicals. Additionally, the presence of both methoxy and thiol functional groups can influence its biological activity, making it a subject of interest in research focused on drug design and development. Safety data should be consulted for handling and storage, as thiol compounds can be sensitive to oxidation and may have specific toxicity profiles.

Formula: C₆H₈N₂O₂S

InChI: InChI=1/C6H8N2O2S/c1-9-4-3-5(10-2)8-6(11)7-4/h3H,1-2H3,(H,7,8,11)

SMILES: COc1cc(nc(n1)S)OC

Synonyms:

• 2-Pyrimidinethiol, 4,6-Dimethoxy-
• 4,6-Dimethoxypyrimidine-2-thiol
• 4,6-dimethoxypyrimidine-2(1H)-thione

2-Mercapto-4,6-dimethoxypyrimidine

CAS: 57235-35-5

Formula: C₆H₈N₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.2049

Ref: IN-DA00EBB2

2-Mercapto-4,6-dimethoxypyrimidine

Controlled Product

CAS: 57235-35-5

2-Mercapto-4,6-dimethoxypyrimidine is a chemical reagent that belongs to the group of dibenzalacetone. This compound has been shown to selectively methylate benzene, dihydric alcohols, and aromatic ethers. It can be used in the chemical industry as a reagent for the production of zirconium metal oxide. 2-Mercapto-4,6-dimethoxypyrimidine has also been found to be an effective catalyst for the synthesis of dodecylbenzene from dimethylbenzene and sodium dodecylbenzenesulfonate.

Formula: C₆H₈N₂O₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 172.21 g/mol

Ref: 3D-FM12077