CAS 57235-50-4
:2-Amino-5-cyclopropyl-1,3,4-thiadiazole
Description:
2-Amino-5-cyclopropyl-1,3,4-thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom in a five-membered ring structure. The compound features an amino group (-NH2) at the 2-position and a cyclopropyl group at the 5-position of the thiadiazole ring, contributing to its unique chemical properties. This structure imparts potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the amino group allows for hydrogen bonding, which can enhance solubility and reactivity. Additionally, the cyclopropyl group can influence the compound's conformational flexibility and steric properties. 2-Amino-5-cyclopropyl-1,3,4-thiadiazole may exhibit various chemical reactivities, including nucleophilic substitution and potential interactions with biological targets. Its CAS number, 57235-50-4, is a unique identifier that facilitates its recognition in chemical databases and literature. Overall, this compound represents a valuable scaffold for further exploration in synthetic and pharmaceutical chemistry.
Formula:C5H7N3S
InChI:InChI=1/C5H7N3S/c6-5-8-7-4(9-5)3-1-2-3/h3H,1-2H2,(H2,6,8)
SMILES:C1CC1c1n[nH]c(=N)s1
Synonyms:- 1,3,4-Thiadiazol-2-Amine, 5-Cyclopropyl-
- 5-Cyclopropyl-1,3,4-Thiadiazol-2-Amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Amino-5-cyclopropyl-1,3,4-thiadiazole, 98%
CAS:2-Amino-5-cyclopropyl-1,3,4-thiadiazole is used as antibacterial agent. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU rFormula:C5H7N3SPurity:98%Color and Shape:Off-white to pale cream, Powder or crystals or crystalline powderMolecular weight:141.25-cyclopropyl-1,3,4-thiadiazol-2-amine
CAS:Formula:C5H7N3SPurity:95%Color and Shape:SolidMolecular weight:141.19425-Cyclopropyl-1,3,4-thiadiazol-2-amine
CAS:5-Cyclopropyl-1,3,4-thiadiazol-2-aminePurity:98%Molecular weight:141.19417g/mol2-Amino-5-cyclopropyl-1,3,4-thiadiazole
CAS:Controlled ProductStability Store in freezer at -20°C
Applications 2-Amino-5-cyclopropyl-1,3,4-thiadiazole (cas# 57235-50-4) is a compound useful in organic synthesis.Formula:C5H7N3SColor and Shape:NeatMolecular weight:141.19





