CAS 57235-54-8

5-cyclopentyl-1,3,4-thiadiazol-2-amine

Description:

5-Cyclopentyl-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a cyclopentyl group. The thiadiazole moiety contributes to its potential biological activity, as compounds containing this functional group are often explored for their pharmacological properties. This substance typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many heterocyclic compounds. The presence of the amine group suggests that it can participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the cyclopentyl substituent can affect the compound's lipophilicity, potentially impacting its absorption and distribution in biological systems. Overall, 5-cyclopentyl-1,3,4-thiadiazol-2-amine is of interest in medicinal chemistry and may serve as a lead compound for further development in drug discovery.

Formula: C₇H₁₁N₃S

InChI: InChI=1/C7H11N3S/c8-7-10-9-6(11-7)5-3-1-2-4-5/h5H,1-4H2,(H2,8,10)

SMILES: C1CCC(C1)c1n[nH]c(=N)s1

Synonyms:

• 1,3,4-Thiadiazol-2-amine, 5-cyclopentyl-
• 5-Cyclopentyl-1,3,4-thiadiazol-2-amine

2-Amino-5-cyclopentyl-1,3,4-thiadiazole

CAS: 57235-54-8

Versatile small molecule scaffold

Formula: C₇H₁₁N₃S

Purity: Min. 95%

Molecular weight: 169.25 g/mol

Ref: 3D-HCA23554