CAS 57250-87-0

4-Thiazolecarboxylic acid, 2-(ethylamino)-, ethyl ester

Description:

4-Thiazolecarboxylic acid, 2-(ethylamino)-, ethyl ester is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound features a carboxylic acid functional group, which is esterified with an ethyl group, indicating that it is an ethyl ester. The presence of the ethylamino group suggests that it has basic properties, which can influence its reactivity and solubility in various solvents. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The thiazole moiety is often associated with various biological functions, including antimicrobial and anti-inflammatory properties. Additionally, the compound's structure may allow for interactions with biological targets, potentially leading to therapeutic applications. Its CAS number, 57250-87-0, provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological contexts.

Formula: C₈H₁₂N₂O₂S

InChI: InChI=1S/C8H12N2O2S/c1-3-9-8-10-6(5-13-8)7(11)12-4-2/h5H,3-4H2,1-2H3,(H,9,10)

InChI key: InChIKey=LBGHMAYKYDOTSC-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N=C(NCC)SC1

Synonyms:

• 4-Thiazolecarboxylic acid, 2-(ethylamino)-, ethyl ester
• Ethyl 2-(ethylamino)thiazole-4-carboxylate

Ethyl 2-(ethylamino)-1,3-thiazole-4-carboxylate

CAS: 57250-87-0

Versatile small molecule scaffold

Formula: C₈H₁₂N₂O₂S

Purity: Min. 95%

Molecular weight: 200.26 g/mol

Ref: 3D-HCA25087