CAS 57252-83-2

3-Methylcyclobutanecarboxylic acid

Description:

3-Methylcyclobutanecarboxylic acid is a cyclic carboxylic acid characterized by its four-membered cyclobutane ring with a methyl group and a carboxylic acid functional group attached. This compound has a molecular formula that reflects its structure, incorporating both carbon and hydrogen atoms, along with the carboxylic acid group (-COOH). It is typically a colorless liquid or solid at room temperature, exhibiting a relatively low boiling point compared to larger carboxylic acids due to its smaller molecular size. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and decarboxylation. Additionally, the methyl group introduces branching, which can influence the compound's physical properties, such as solubility and volatility. 3-Methylcyclobutanecarboxylic acid may be used in organic synthesis and could serve as an intermediate in the production of more complex chemical compounds. Its unique structure makes it of interest in both academic research and potential industrial applications.

Formula: C₆H₁₀O₂

InChI: InChI=1S/C6H10O2/c1-4-2-5(3-4)6(7)8/h4-5H,2-3H2,1H3,(H,7,8)

InChI key: InChIKey=ZLXHOVJKNATDMT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC(C)C1

Synonyms:

• 3-Methylcyclobutylcarboxylic acid
• 3-Methylcyclobutanecarboxylic acid
• Cyclobutanecarboxylic acid, 3-methyl-
• 3-Methylcyclobutane-1-carboxylic acid

3-Methylcyclobutanecarboxylic acid

CAS: 57252-83-2

Formula: C₆H₁₀O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 114.1424

Ref: IN-DA0037K5

3-Methylcyclobutane-1-carboxylic acid

CAS: 57252-83-2

3-Methylcyclobutane-1-carboxylic acid

Purity: 95%

Molecular weight: 114.14g/mol

Ref: 54-OR926901

3-Methylcyclobutanecarboxylic acid

CAS: 57252-83-2

Formula: C₆H₁₀O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 114.144

Ref: 10-F091989