CymitQuimica logo

CAS 5726-48-7

:

ethyl 2-amino-5-[(4-methoxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate

Description:
Ethyl 2-amino-5-[(4-methoxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate, with the CAS number 5726-48-7, is a chemical compound characterized by its complex structure, which includes a thiophene ring, an amino group, and an ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the methoxyphenyl group may contribute to its electronic properties, potentially influencing its reactivity and interactions in biological systems. Additionally, the carboxylate and amino functionalities suggest that it may engage in hydrogen bonding, which can affect its solubility and biological activity. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory or antimicrobial activities. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C16H18N2O4S
InChI:InChI=1/C16H18N2O4S/c1-4-22-16(20)12-9(2)13(23-14(12)17)15(19)18-10-5-7-11(21-3)8-6-10/h5-8H,4,17H2,1-3H3,(H,18,19)
SMILES:CCOC(=O)c1c(C)c(C(=Nc2ccc(cc2)OC)O)sc1N
Synonyms:
  • 2-Amino-5-(4-methoxy-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester
  • 3-Thiophenecarboxylic Acid, 2-Amino-5-[[(4-Methoxyphenyl)Amino]Carbonyl]-4-Methyl-, Ethyl Ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.