CAS 57268-33-4
:2-[1-(Aminocarbonyl)-2-[[5-(4-nitrophenyl)-2-furanyl]methylene]hydrazinyl]acetic acid
Description:
2-[1-(Aminocarbonyl)-2-[[5-(4-nitrophenyl)-2-furanyl]methylene]hydrazinyl]acetic acid, with the CAS number 57268-33-4, is a chemical compound that features a complex structure characterized by the presence of a hydrazine moiety, a furan ring, and an aminocarbonyl group. This compound is typically classified as a hydrazone derivative, which indicates that it contains a hydrazone functional group formed from the reaction of a hydrazine with a carbonyl compound. The presence of the nitrophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the electron-withdrawing nature of the nitro group, which can influence the compound's reactivity and biological activity. Additionally, the carboxylic acid functional group contributes to its solubility in polar solvents and may play a role in its interaction with biological targets. Overall, this compound's unique structural features may confer specific properties that are of interest in various chemical and biological applications.
Formula:C14H12N4O6
InChI:InChI=1S/C14H12N4O6/c15-14(21)17(8-13(19)20)16-7-11-5-6-12(24-11)9-1-3-10(4-2-9)18(22)23/h1-7H,8H2,(H2,15,21)(H,19,20)
InChI key:InChIKey=RGDXLIJGJXVFDO-UHFFFAOYSA-N
SMILES:C(=NN(CC(O)=O)C(N)=O)C=1OC(=CC1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- Acetic acid, 2-[1-(aminocarbonyl)-2-[[5-(4-nitrophenyl)-2-furanyl]methylene]hydrazinyl]-
- 2-[1-(Aminocarbonyl)-2-[[5-(4-nitrophenyl)-2-furanyl]methylene]hydrazinyl]acetic acid
- Acetic acid, [(aminocarbonyl)[[5-(4-nitrophenyl)-2-furanyl]methylene]hydrazino]-
- Dantrolene Impurity 2
- 5-(4-Nitrophenyl)-2-furaldehyde-(2-carboxyMethyl) SeMicarbazone
- Dantrolene Related Compound B (50 mg) (5-(4-nitrophenyl)-2-furaldehyde-(2-carboxymethyl) semicarbazone)
- Dantrolene USP Related Compound B
- Dantrolene Related CoMpound B
- [(Aminocarbonyl)[[5-(4-nitrophenyl)-2-furanyl]methylene]hydrazino]acetic acid
- Dantrolene impurity B
- Dantrolene USP RC B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dantrolene Related Compound B (5-(4-nitrophenyl)-2-furaldehyde-(2-carboxymethyl) semicarbazone)
CAS:Compounds containing an unfused furan ring (whether or not hydrogenated) in the structure nesoiFormula:C14H12N4O6Color and Shape:Yellow PowderMolecular weight:332.07568Dantrolene Related Compound B (50 mg) (5-(4-nitrophenyl)-2-furaldehyde-(2-carboxymethyl) semicarbazone)
CAS:Formula:C14H12N4O6Purity:99%Color and Shape:SolidMolecular weight:332.26835-(4-Nitrophenyl)-2-furaldehyde-(2-carboxymethyl) Semicarbazone
CAS:Controlled ProductFormula:C14H12N4O6Color and Shape:NeatMolecular weight:332.27[(Aminocarbonyl)[[5-(4-nitrophenyl)-2-furanyl]methylene]hydrazino]-acetic acid
CAS:Please enquire for more information about [(Aminocarbonyl)[[5-(4-nitrophenyl)-2-furanyl]methylene]hydrazino]-acetic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C14H12N4O6Purity:Min. 95%Molecular weight:332.27 g/mol






