CAS 57268-39-0
:5-(4-acetylphenyl)furan-2-carbaldehyde
Description:
5-(4-Acetylphenyl)furan-2-carbaldehyde is an organic compound characterized by its furan and aldehyde functional groups, along with an acetylphenyl substituent. This compound features a furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom, contributing to its reactivity and potential applications in organic synthesis. The presence of the aldehyde group indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The acetylphenyl moiety enhances its aromatic character and may influence its solubility and reactivity. This compound is typically used in research and development, particularly in the synthesis of more complex organic molecules, and may exhibit biological activity, making it of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many organic compounds, safety precautions should be observed when handling it, given the potential hazards associated with its chemical structure.
Formula:C13H10O3
InChI:InChI=1/C13H10O3/c1-9(15)10-2-4-11(5-3-10)13-7-6-12(8-14)16-13/h2-8H,1H3
SMILES:CC(=O)c1ccc(cc1)c1ccc(C=O)o1
Synonyms:- 2-Furancarboxaldehyde, 5-(4-acetylphenyl)-
- 5-(4-Acetylphenyl)-2-furaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-(4-Acetylphenyl)-2-furaldehyde
CAS:5-(4-Acetylphenyl)-2-furaldehyde is a fine chemical that is a versatile building block for synthesis of complex compounds. It has been used as an intermediate in the production of polyurethanes and polyesters. This compound has also been shown to be an effective reaction component in the preparation of research chemicals, such as 2,5-diacetylbenzoic acid and 4-acetamidophenol. 5-(4-Acetylphenyl)-2-furaldehyde is a high quality reagent with CAS No. 57268-39-0 that can be used in the synthesis of speciality chemicals.Formula:C13H10O3Purity:Min. 95%Color and Shape:PowderMolecular weight:214.22 g/mol
