CAS 57276-28-5

cyclopropyl(pyridin-2-yl)methanone

Description:

Cyclopropyl(pyridin-2-yl)methanone, with the CAS number 57276-28-5, is an organic compound characterized by the presence of a cyclopropyl group and a pyridine ring attached to a carbonyl functional group. This compound features a three-membered cyclopropyl ring, which contributes to its unique reactivity and strain characteristics. The pyridine moiety, a six-membered aromatic ring containing a nitrogen atom, imparts basicity and potential for coordination with metal ions. The carbonyl group (C=O) is a key functional group that influences the compound's reactivity, making it susceptible to nucleophilic attack. Cyclopropyl(pyridin-2-yl)methanone may exhibit interesting biological activities and could serve as a building block in the synthesis of more complex molecules. Its properties, such as solubility, melting point, and stability, can vary based on the specific conditions and solvents used. Overall, this compound is of interest in organic synthesis and medicinal chemistry due to its structural features and potential applications.

Formula: C₉H₉NO

InChI: InChI=1/C9H9NO/c11-9(7-4-5-7)8-3-1-2-6-10-8/h1-3,6-7H,4-5H2

SMILES: c1ccnc(c1)C(=O)C1CC1

Synonyms:

• Cyclopropyl(2-pyridinyl)methanone
• Methanone, Cyclopropyl-2-Pyridinyl-

Cyclopropyl(pyridin-2-yl)methanone

CAS: 57276-28-5

Formula: C₉H₉NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.1739

Ref: IN-DA003P72

Cyclopropyl(pyridin-2-yl)methanone

CAS: 57276-28-5

Cyclopropyl(pyridin-2-yl)methanone

Purity: 95%

Molecular weight: 147.17g/mol

Ref: 54-OR929500

2-Cyclopropanecarbonylpyridine

CAS: 57276-28-5

Purity: 98%

Molecular weight: 147.18

Ref: 10-F662884

Cyclopropyl(2-pyridyl)methanone

CAS: 57276-28-5

Cyclopropyl(2-pyridyl)methanone is a ketone with a pyridyl group. It has the maximum absorption at 422 nm and minimal absorption at 619 nm. The Raman spectra of this compound show two peaks at 1607 cm−1 and 1592 cm−1, which correspond to the ketone and methyl ketone conformations respectively. Cyclopropyl(2-pyridyl)methanone can be synthesized by reacting cyclopropane with 2-pyridinecarboxaldehyde in the presence of a base. This reaction is reversible as it produces methyl formate and acetone. Cyclopropyl(2-pyridyl)methanone has been used as an additive in cosmetics, paints, and plastics to increase their stability.

Formula: C₉H₉NO

Purity: Min. 95%

Molecular weight: 147.18 g/mol

Ref: 3D-HCA27628