CAS 5728-44-9

N-(4-carboxyphenyl)-alpha-D-xylopyranosylamine

Description:

N-(4-carboxyphenyl)-alpha-D-xylopyranosylamine, with the CAS number 5728-44-9, is a chemical compound that features a xylopyranosylamine structure, which is a sugar derivative. This compound is characterized by the presence of a carboxyphenyl group, which contributes to its potential reactivity and solubility properties. The xylopyranosyl moiety indicates that it is a sugar-based compound, likely exhibiting properties typical of carbohydrates, such as being hydrophilic due to the presence of hydroxyl groups. The carboxylic acid functional group enhances its acidity and can participate in various chemical reactions, including esterification and amidation. This compound may also exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways or as a building block for more complex molecules. Overall, N-(4-carboxyphenyl)-alpha-D-xylopyranosylamine represents a unique intersection of carbohydrate chemistry and functional group reactivity.

Formula: C₁₄H₉NO₂

InChI: InChI=1/C12H15NO6/c14-8-5-19-11(10(16)9(8)15)13-7-3-1-6(2-4-7)12(17)18/h1-4,8-11,13-16H,5H2,(H,17,18)/t8-,9+,10-,11+/m1/s1

Synonyms:

• [1,1'-Biphenyl]-4-carboxylic acid, 2'-cyano-
• 2'-Cyano-[1,1'-biphenyl]-4-carboxylic acid
• 4-(2-Cyanophenyl)benzoic acid
• 2'-Cyano-4-biphenylcarboxylic acid

4-(2-Cyanophenyl)benzoic acid

CAS: 5728-44-9

Formula: C₁₄H₉NO₂

Purity: 95%

Molecular weight: 223.2268

Ref: IN-DA00EIHF

2′-Cyano[1,1′-biphenyl]-4-carboxylic acid

CAS: 5728-44-9

Formula: C₁₄H₉NO₂

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 223.231

Ref: 10-F041453

2'-Cyano[1,1'-biphenyl]-4-carboxylic acid

CAS: 5728-44-9

Versatile small molecule scaffold

Formula: C₁₄H₉NO₂

Purity: Min. 95%

Molecular weight: 223.23 g/mol

Ref: 3D-FAA72844