CAS 57281-78-4
:Glycyl-L-cysteine
Description:
Glycyl-L-cysteine is a dipeptide composed of the amino acids glycine and L-cysteine, linked by a peptide bond. It is characterized by its relatively small size and the presence of a thiol group (-SH) from the cysteine residue, which imparts unique biochemical properties, such as the ability to participate in redox reactions and form disulfide bonds. This compound is often studied for its potential antioxidant properties, as it can scavenge free radicals and protect cells from oxidative stress. Glycyl-L-cysteine is soluble in water, making it suitable for various biological applications. It plays a role in cellular metabolism and may be involved in the synthesis of glutathione, a critical antioxidant in the body. Additionally, its structure allows it to interact with various biological molecules, influencing processes such as protein folding and enzyme activity. Overall, Glycyl-L-cysteine is significant in biochemistry and pharmacology, with potential implications in health and disease management.
Formula:C5H10N2O3S
InChI:InChI=1S/C5H10N2O3S/c6-1-4(8)7-3(2-11)5(9)10/h3,11H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1
InChI key:InChIKey=MFBYPDKTAJXHNI-VKHMYHEASA-N
SMILES:[C@@H](NC(CN)=O)(C(O)=O)CS
Synonyms:- L-Cysteine, N-glycyl-
- L-Cysteine, glycyl-
- Cysteine, N-glycyl-
- Glycyl-L-cysteine
- Glycylcysteine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Gly-Cys-OH
CAS:H-Gly-Cys-OH is an amide that is structurally related to the nonapeptide, Gly-Pro-Cys. H-Gly-Cys-OH has been shown to be an efficient method for preparation of 3-mercaptopropionic acid. The nucleophilic attack of the thiol group on the carbonyl carbon atom in the amide bond leads to cleavage and formation of a disulfide bond. This reaction occurs spontaneously at room temperature with high efficiency and can be used for synthesis of 3-mercaptopropionic acid. H-Gly-Cys-OH has low bioavailability, which may be due to its primary amino group, which is not well absorbed by the intestinal epithelium.
Formula:C5H10N2O3SPurity:Min. 95%Molecular weight:178.21 g/molH-Gly-Cys-OH
CAS:Inhibitor of carboxypeptidase U (thrombin activatable fibrinolysis inhibitor, TAFI), Ki 0.14 μM.Formula:C5H10N2O3SPurity:> 90%Color and Shape:Whitish PowderMolecular weight:178.21

