CAS 57282-61-8
:(2R,3S,4S,5S,6R)-6-[(2S,3S,4R,5S,6S)-3-acetamido-2-[(2R,3S,4R,5S,6R)-6-[(3S,4R,5S,6S)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxy-2-carboxy-4,5-dihydroxy-tetrahydropyran-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxy-
Description:
The chemical substance with the name "(2R,3S,4S,5S,6R)-6-[(2S,3S,4R,5S,6S)-3-acetamido-2-[(2R,3S,4R,5S,6R)-6-[(3S,4R,5S,6S)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxy-2-carboxy-4,5-dihydroxy-tetrahydropyran-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxy-" and CAS number "57282-61-8" is a complex glycosylated compound characterized by multiple hydroxyl and acetamido functional groups. This structure suggests it may exhibit significant solubility in polar solvents, particularly water, due to the presence of hydroxyl groups that can form hydrogen bonds. The stereochemistry indicated by the R and S designations suggests that the molecule has specific three-dimensional orientations, which can influence its biological activity and interactions with enzymes or receptors. Such compounds are often of interest in medicinal chemistry, particularly in the development of antibiotics or other therapeutics, due to their potential to mimic natural substrates or inhibit biological pathways. The intricate structure also implies that it may have a role in biological systems, possibly as a carbohydrate derivative or in cellular signaling processes.
Formula:C28H44N2O23
InChI:InChI=1/C28H44N2O23/c1-5(33)29-9-18(11(35)7(3-31)47-25(9)46)49-28-17(41)15(39)20(22(53-28)24(44)45)51-26-10(30-6(2)34)19(12(36)8(4-32)48-26)50-27-16(40)13(37)14(38)21(52-27)23(42)43/h7-22,25-28,31-32,35-41,46H,3-4H2,1-2H3,(H,29,33)(H,30,34)(H,42,43)(H,44,45)/t7-,8-,9-,10-,11+,12+,13-,14-,15+,16-,17-,18+,19+,20-,21+,22+,25?,26-,27+,28+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Hyaluronate Tetrasaccharide
CAS:Formula:C28H44N2O23Color and Shape:White to Almost white powder to crystalMolecular weight:776.65Hyaluronate Tetrasaccharide
CAS:Formula:C28H44N2O23Purity:98%Color and Shape:SolidMolecular weight:776.6486Hyaluronic acid tetrasaccharide
CAS:<p>Hyaluronic acid is a polysaccharide containing repeating disaccharide units of 1,3-N-acetyl glucosamine and 1, 4-glucuronic acid. This tetrasaccharide and other enzymatically produced polymer homologs have been of value in the study of hyaluronic acid metabolism in both healthy and diseased tissues (Hascall, 2019).</p>Formula:C28H44N2O23Purity:Min. 95%Color and Shape:White PowderMolecular weight:776.65 g/mol



