CymitQuimica logo

CAS 57292-30-5

:

6-chloro-1-{[2-(ethylamino)ethyl]amino}-4-(hydroxymethyl)-9H-thioxanthen-9-one

Description:
6-Chloro-1-{[2-(ethylamino)ethyl]amino}-4-(hydroxymethyl)-9H-thioxanthen-9-one is a synthetic organic compound characterized by its complex structure, which includes a thioxanthenone core, a chloro substituent, and an ethylamino side chain. This compound typically exhibits properties associated with thioxanthene derivatives, such as potential biological activity, including antipsychotic or neuroleptic effects, due to its ability to interact with neurotransmitter systems. The presence of the hydroxymethyl group may enhance its solubility and reactivity, while the chloro group can influence its pharmacological profile. The ethylamino moiety suggests potential for interaction with biological targets, possibly affecting its efficacy and safety profile. As with many compounds in medicinal chemistry, the specific characteristics, including solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Further studies would be necessary to fully elucidate its biological activity and potential therapeutic applications.
Formula:C18H19ClN2O2S
InChI:InChI=1/C18H19ClN2O2S/c1-2-20-7-8-21-14-6-3-11(10-22)18-16(14)17(23)13-5-4-12(19)9-15(13)24-18/h3-6,9,20-22H,2,7-8,10H2,1H3
Synonyms:
  • 6-Chloro-1-{[2-(ethylamino)ethyl]amino}-4-(hydroxymethyl)-9H-thioxanthen-9-one
  • 9H-thioxanthen-9-one, 6-chloro-1-[[2-(ethylamino)ethyl]amino]-4-(hydroxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.