CAS 57294-46-9
:benzyl N-[(benzyloxy)carbonyl]glycyltyrosinate
Description:
Benzyl N-[(benzyloxy)carbonyl]glycyltyrosinate is a synthetic compound that belongs to the class of amino acid derivatives. It features a benzyl group, which contributes to its hydrophobic characteristics, and a glycine moiety that is linked to a tyrosine residue, providing it with potential biological activity. The presence of the benzyloxycarbonyl group indicates that it may be used as a protecting group in peptide synthesis, enhancing its utility in organic chemistry and biochemistry. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic components, while its polar amino acid segments may impart some degree of solubility in aqueous environments. The structure suggests potential applications in drug development, particularly in the design of peptide-based therapeutics. Additionally, the compound may exhibit interesting interactions with biological targets, making it a candidate for further research in medicinal chemistry. As with many synthetic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound are not well-documented.
Formula:C26H26N2O6
InChI:InChI=1/C26H26N2O6/c29-22-13-11-19(12-14-22)15-23(25(31)33-17-20-7-3-1-4-8-20)28-24(30)16-27-26(32)34-18-21-9-5-2-6-10-21/h1-14,23,29H,15-18H2,(H,27,32)(H,28,30)
SMILES:c1ccc(cc1)COC(=O)C(Cc1ccc(cc1)O)N=C(CN=C(O)OCc1ccccc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
