CAS 57294-74-3
:Uridine 4-hydrazone
Description:
Uridine 4-hydrazone is a chemical compound derived from uridine, a nucleoside that consists of a ribose sugar and the nitrogenous base uracil. This compound features a hydrazone functional group, which is formed by the reaction of hydrazine with a carbonyl compound, in this case, the carbonyl group of uridine. Uridine 4-hydrazone is characterized by its potential biological activity, particularly in the context of nucleoside analogs, which can influence various biochemical pathways. It may exhibit properties such as antiviral or anticancer activity, although specific mechanisms and efficacy can vary. The compound is typically studied in the context of medicinal chemistry and pharmacology, where its interactions with biological targets are of interest. Additionally, its solubility, stability, and reactivity can be influenced by the surrounding pH and the presence of other chemical species. As with many hydrazones, it may also be sensitive to oxidation and can undergo further reactions under certain conditions.
Formula:C9H14N4O5
InChI:InChI=1S/C9H14N4O5/c10-12-5-1-2-13(9(17)11-5)8-7(16)6(15)4(3-14)18-8/h1-2,4,6-8,14-16H,3,10H2,(H,11,12,17)/t4-,6-,7-,8-/m1/s1
InChI key:InChIKey=RSSRMDMJEZIUJX-XVFCMESISA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)NC(=NN)C=C2
Synonyms:- 4-hydrazino-1-pentofuranosylpyrimidin-2(1H)-one
- 4-hydrazinyl-1-(D-ribofuranosyl)pyrimidin-2(1H)-one
- Ccris 2527
- Cytidine, N-amino-
- Eidd 1910
- N(4)-Aminocytidine
- N(sup 4)-Aminocytidine
- N<sup>4</sup>-Aminocytidine
- Uridine, 4-hydrazone
- N4-Aminocytidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N4-Aminocytidine
CAS:Formula:C9H14N4O5Purity:≥ 95.0%Color and Shape:White to light-yellow powderMolecular weight:258.23N4-Aminocytidine
CAS:N4-Aminocytidine is an analog of uridine that can be used as an inhibitor of the growth of bacteria. It has been shown to inhibit the growth of Escherichia coli and Salmonella typhimurium in vitro. N4-Aminocytidine binds to the bacterial ribosome and inhibits protein synthesis, which results in cell death. This drug has also been found to act as a potent synthetic cannabinoid receptor agonist in vivo and inhibits uptake of cannabinoids into cells in culture. N4-Aminocytidine has also been shown to bind to dna duplexes and chemically react with them, altering their structure. This drug has not yet been tested for safety or efficacy in humans.Formula:C9H14N4O5Purity:Min. 95%Color and Shape:PowderMolecular weight:258.23 g/molN4-Aminocytidine
CAS:Controlled ProductApplications N4-Aminocytidine (cas# 57294-74-3) is a useful research chemical.
Formula:C9H14N4O5Color and Shape:NeatMolecular weight:258.23




