CAS 573-11-5
:2,3,4-Trimethoxybenzoic acid
Description:
2,3,4-Trimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of three methoxy groups (-OCH3) attached to a benzoic acid structure. The methoxy groups are located at the 2, 3, and 4 positions on the benzene ring, contributing to the compound's unique chemical properties. This compound is typically a white to off-white crystalline solid and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the methoxy groups. It exhibits moderate acidity, typical of carboxylic acids, and can participate in various chemical reactions, including esterification and acylation. The presence of multiple methoxy groups can enhance its reactivity and influence its biological activity, making it of interest in medicinal chemistry and organic synthesis. Additionally, 2,3,4-trimethoxybenzoic acid may exhibit antioxidant properties and has potential applications in pharmaceuticals and agrochemicals. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C10H12O5
InChI:InChI=1S/C10H12O5/c1-13-7-5-4-6(10(11)12)8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12)
InChI key:InChIKey=HZNQSWJZTWOTKM-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(OC)=CC=C1C(O)=O
Synonyms:- 2,3,4-Trimethoxybenzoate
- Benzoic acid, 2,3,4-trimethoxy-
- 2,3,4-Trimethoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3,4-Trimethoxybenzoic Acid
CAS:Formula:C10H12O5Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:212.202,3,4-Trimethoxybenzoic acid, 98+%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H11O5Purity:98+%Color and Shape:White, PowderMolecular weight:211.192,3,4-Trimethoxybenzoic acid
CAS:2,3,4-Trimethoxybenzoic acidPurity:98%Color and Shape:Off-White PowderMolecular weight:212.20g/mol2,3,4-Trimethoxybenzoic acid
CAS:2,3,4-Trimethoxybenzoic acid is a molecule that has been shown to stimulate epidermal growth. It is a methylating agent that can be used to produce 2-hydroxybenzoic acid from protocatechuic acid. The hydroxy group on the 2,3,4-trimethoxybenzoic acid binds to the chloride ion in the protocatechuic acid and removes it from the molecule. This reaction mechanism is supported by x-ray crystal structures of protocatechuic acid and 2,3,4-trimethoxybenzoic acid.Formula:C10H12O5Purity:Min. 95%Color and Shape:PowderMolecular weight:212.2 g/mol2,3,4-Trimethoxybenzoic acid
CAS:Formula:C10H12O5Purity:97%Color and Shape:SolidMolecular weight:212.201




