CAS 573-12-6
:phenanthrene-1,2-dione
Description:
Phenanthrene-1,2-dione, with the CAS number 573-12-6, is a polycyclic aromatic compound characterized by its structure, which features a phenanthrene backbone with two ketone functional groups at the 1 and 2 positions. This compound typically appears as a yellow to orange solid and is known for its aromatic properties, which contribute to its stability and reactivity. Phenanthrene-1,2-dione is soluble in organic solvents such as acetone and ethanol but has limited solubility in water. It exhibits strong UV-Vis absorption characteristics, making it useful in various applications, including organic synthesis and as a potential intermediate in the production of dyes and pharmaceuticals. Additionally, it can participate in redox reactions due to the presence of the carbonyl groups, allowing it to act as a reducing agent or an electron acceptor in certain chemical processes. Its reactivity and properties make it a subject of interest in both synthetic organic chemistry and materials science.
Formula:C14H8O2
InChI:InChI=1/C14H8O2/c15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16/h1-8H
InChI key:InChIKey=SCOAVUHOIJMIBW-UHFFFAOYSA-N
SMILES:O=C1C2=C(C=3C(C=C2)=CC=CC3)C=CC1=O
Synonyms:- 1,2-Dihydrophenanthrene-1,2-dione
- 1,2-Phenanthrenedione
- 7,8-Phenanthraquinone
- 1,2-Phenanthrenequinone
- 1,2-Phenanthraquinone
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
