CAS 573-79-5
:2,2′-(1-Oxido-1,2-diazenediyl)bis[benzoic acid]
Description:
2,2′-(1-Oxido-1,2-diazenediyl)bis[benzoic acid], also known by its CAS number 573-79-5, is an organic compound characterized by its structure, which features two benzoic acid moieties connected by a diazenediyl (N=N) linkage. This compound is a derivative of benzoic acid, which contributes to its acidic properties. The presence of the diazenediyl group introduces unique reactivity, particularly in redox reactions, and can influence the compound's stability and solubility in various solvents. Typically, compounds like this may exhibit moderate to high melting points and can be soluble in polar solvents due to the carboxylic acid functional groups. Additionally, the compound may display interesting biological activities, making it of interest in various fields, including medicinal chemistry and materials science. Its synthesis often involves coupling reactions, and it may be used as a precursor for more complex organic molecules or as a reagent in chemical synthesis. Safety data should be consulted for handling, as with all chemical substances.
Formula:C14H10N2O5
InChI:InChI=1S/C14H10N2O5/c17-13(18)9-5-1-3-7-11(9)15-16(21)12-8-4-2-6-10(12)14(19)20/h1-8H,(H,17,18)(H,19,20)
InChI key:InChIKey=MBUVKGDWMUDLBP-UHFFFAOYSA-N
SMILES:N(=N(=O)C1=C(C(O)=O)C=CC=C1)C2=C(C(O)=O)C=CC=C2
Synonyms:- 2,2′-(1-Oxido-1,2-diazenediyl)bis[benzoic acid]
- 2,2′-Azoxydibenzoic acid
- 2,2′-Dicarboxyazoxybenzene
- 2-[(Z)-(2-carboxyphenyl)-NNO-azoxy]benzoic acid
- Azoxybenzene-2,2′-dicarboxylic acid
- Benzoic acid, 2,2′-(1-oxido-1,2-diazenediyl)bis-
- Benzoic acid, 2,2′-azoxybis-
- Benzoic acid, 2,2′-azoxydi-
- o,o′-Azoxybenzenedicarboxylic acid
- 2,2'-Azoxybisbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,2'-Azoxydibenzoic acid
CAS:<p>2,2'-azoxydibenzoic acid is a high quality chemical that is used as a reagent, complex compound, and research chemical. It has CAS No. 573-79-5 and has the molecular formula of C8H4N2O4. This compound is useful as an intermediate, fine chemical, or speciality chemical in synthesis. 2,2'-Azoxydibenzoic acid can be used as a building block for scaffolds or as a versatile building block in reaction components.</p>Formula:C14H10N2O5Purity:Min. 95%Molecular weight:286.24 g/mol
