CAS 573-90-0

N-methyl-N-1-naphthylacetamide

Description:

N-methyl-N-1-naphthylacetamide, with the CAS number 573-90-0, is an organic compound characterized by its amide functional group. It features a naphthalene ring, which contributes to its aromatic properties, and a methyl group attached to the nitrogen atom of the amide. This compound is typically a white to off-white solid at room temperature and is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic naphthalene structure. N-methyl-N-1-naphthylacetamide is often studied for its potential applications in pharmaceuticals and as a chemical intermediate in organic synthesis. Its molecular structure allows for interactions that can influence biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid inhalation or skin contact. Overall, this compound exemplifies the diverse nature of amides in organic chemistry.

Formula: C₁₃H₁₃NO

InChI: InChI=1/C13H13NO/c1-10(15)14(2)13-9-5-7-11-6-3-4-8-12(11)13/h3-9H,1-2H3

SMILES: CC(=O)N(C)c1cccc2ccccc12

Synonyms:

• N-methyl-N-(naphthalen-1-yl)acetamide

N-Methyl-N-1-naphthalenylacetamide

Controlled Product

CAS: 573-90-0

Applications N-Methyl-N-1-naphthalenylacetamide is a useful compound for organic synthesis.

Formula: C₁₃H₁₃NO

Color and Shape: Neat

Molecular weight: 199.25

Ref: TR-M881230