CAS 5730-77-8

2′-Amino[1,1′-biphenyl]-4-carboxylic acid

Description:

2′-Amino[1,1′-biphenyl]-4-carboxylic acid, also known as 4-carboxy-2-aminobiphenyl, is an organic compound characterized by the presence of an amino group and a carboxylic acid group attached to a biphenyl structure. This compound typically appears as a solid and is soluble in polar solvents due to its functional groups. It exhibits properties such as being a potential intermediate in organic synthesis and may be utilized in the production of dyes, pharmaceuticals, and agrochemicals. The amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, while the carboxylic acid group can engage in acid-base reactions and form esters or amides. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₁₁NO₂

InChI: InChI=1S/C13H11NO2/c14-12-4-2-1-3-11(12)9-5-7-10(8-6-9)13(15)16/h1-8H,14H2,(H,15,16)

InChI key: InChIKey=WHEDDMZOIILSJP-UHFFFAOYSA-N

SMILES: NC1=C(C2=CC=C(C(O)=O)C=C2)C=CC=C1

Synonyms:

• 2′-Amino[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 2′-amino-
• 4-Biphenylcarboxylic acid, 2′-amino-
• 2′-Aminobiphenyl-4-carboxylic acid

2′-Amino-biphenyl-4-carboxylic acid

CAS: 5730-77-8

Formula: C₁₃H₁₁NO₂

Color and Shape: Solid

Molecular weight: 213.236

Ref: 10-F031920

2'-Aminobiphenyl-4-carboxylic acid

CAS: 5730-77-8

Versatile small molecule scaffold

Formula: C₁₃H₁₁NO₂

Purity: Min. 95%

Molecular weight: 213.23 g/mol

Ref: 3D-FAA73077