CAS 5731-10-2
:4'-fluorobiphenyl-4-carboxylate
Description:
4'-Fluorobiphenyl-4-carboxylate, with the CAS number 5731-10-2, is an organic compound that features a biphenyl structure substituted with a fluorine atom and a carboxylate group. This compound is characterized by its aromatic nature, which contributes to its stability and potential reactivity. The presence of the fluorine atom can influence the electronic properties of the molecule, often enhancing its lipophilicity and altering its interaction with biological systems. The carboxylate group, being a deprotonated form of a carboxylic acid, imparts polar characteristics, making the compound more soluble in polar solvents compared to its non-polar counterparts. This dual nature allows for diverse applications in organic synthesis, pharmaceuticals, and materials science. Additionally, the compound may exhibit interesting properties such as fluorescence or specific reactivity patterns due to the arrangement of its substituents. Overall, 4'-fluorobiphenyl-4-carboxylate serves as a valuable building block in various chemical applications.
Formula:C13H9FO2
InChI:InChI=1/C13H9FO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h1-8H,(H,15,16)/p-1
SMILES:c1cc(ccc1c1ccc(cc1)F)C(=O)[O-]
Synonyms:- [1,1'-Biphenyl]-4-carboxylic acid, 4'-fluoro-
- 4'-Fluorobiphenyl-4-carboxylic acid
- 4-Biphenyl-4-Fluoro-Carboxylic Acid
- 4-(4-Fluorophenyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4'-Fluorobiphenyl-4-carboxylic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H8FO2Purity:96%Color and Shape:White to pale cream or grey to dark grey, PowderMolecular weight:215.204-(4-Fluorophenyl)benzoic acid
CAS:Formula:C13H9FO2Purity:98%Color and Shape:SolidMolecular weight:216.20784'-Fluoro-[1,1'-biphenyl]-4-carboxylic acid
CAS:4'-Fluoro-[1,1'-biphenyl]-4-carboxylic acidFormula:C13H9FO2Purity:98%Color and Shape: off white powderMolecular weight:216.20776g/mol4′-Fluorobiphenyl-4-carboxylic acid
CAS:Formula:C13H9FO2Purity:98%Color and Shape:SolidMolecular weight:216.2114-(4-Fluorophenyl)benzoic acid
CAS:Controlled ProductApplications 4-(4-Fluorophenyl)benzoic acid
Formula:C13H9FO2Color and Shape:NeatMolecular weight:216.21





