CAS 57332-75-9

imidazo[2,1-b][1,3]thiazol-6-ylacetate

Description:

Imidazo[2,1-b][1,3]thiazol-6-ylacetate is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. The presence of the acetate group contributes to its solubility and reactivity, influencing its interaction with biological targets. Imidazo[2,1-b][1,3]thiazol derivatives are often studied for their potential as antimicrobial, anti-inflammatory, and anticancer agents. The compound's molecular structure allows for various substitution patterns, which can significantly affect its pharmacological properties. Additionally, it may exhibit moderate to high stability under standard laboratory conditions, although specific stability and reactivity can depend on the surrounding environment and conditions. Overall, imidazo[2,1-b][1,3]thiazol-6-ylacetate represents a versatile scaffold in organic synthesis and pharmaceutical research, with ongoing studies aimed at elucidating its full therapeutic potential.

Formula: C₇H₅N₂O₂S

InChI: InChI=1/C7H6N2O2S/c10-6(11)3-5-4-9-1-2-12-7(9)8-5/h1-2,4H,3H2,(H,10,11)/p-1

SMILES: c1csc2nc(CC(=O)[O-])cn12

2-(Imidazo[2,1-b]thiazol-6-yl)acetic acid

CAS: 57332-75-9

2-(Imidazo[2,1-b]thiazol-6-yl)acetic acid

Purity: 98%

Molecular weight: 182.2g/mol

Ref: 54-OR1059531

imidazo[2,1-b][1,3]thiazol-6-ylacetic acid

CAS: 57332-75-9

Formula: C₇H₆N₂O₂S

Purity: 95.0%

Molecular weight: 182.2

Ref: 10-F313780

2-(Imidazo[2,1-b]thiazol-6-yl)acetic acid

CAS: 57332-75-9

Versatile small molecule scaffold

Formula: C₇H₆N₂O₂S

Purity: Min. 95%

Molecular weight: 182.2 g/mol

Ref: 3D-HCA33275