CymitQuimica logo

CAS 57332-78-2

:

ethyl 5-methyl-2-thioxo-2,3-dihydro-1H-imidazole-4-carboxylate

Description:
Ethyl 5-methyl-2-thioxo-2,3-dihydro-1H-imidazole-4-carboxylate, identified by its CAS number 57332-78-2, is a chemical compound that belongs to the class of imidazole derivatives. This compound features a thioxo group, which contributes to its unique reactivity and potential biological activity. It typically exhibits a molecular structure characterized by a five-membered imidazole ring, which is known for its presence in various biological molecules, including amino acids and nucleotides. The ethyl ester functional group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the methyl group at the 5-position of the imidazole ring can influence its steric and electronic properties, potentially affecting its interactions with biological targets. Overall, this compound may be of interest in research related to pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its unique structural features and potential reactivity.
Formula:C7H10N2O2S
InChI:InChI=1/C7H10N2O2S/c1-3-11-6(10)5-4(2)8-7(12)9-5/h3H2,1-2H3,(H2,8,9,12)
SMILES:CCOC(=O)c1c(C)nc([nH]1)S
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.