CAS 57338-76-8
:2,5-dimethyl-1H-pyrrole-3-carboxylic acid
Description:
2,5-Dimethyl-1H-pyrrole-3-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two methyl groups at the 2 and 5 positions of the pyrrole ring and a carboxylic acid functional group at the 3 position, contributing to its acidic properties. The presence of the carboxylic acid group allows for hydrogen bonding and increases its solubility in polar solvents, making it more reactive in various chemical reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure imparts unique electronic properties, which can influence its reactivity and interactions with other molecules. Additionally, the presence of the methyl groups can affect the steric hindrance and overall stability of the compound. As with many organic acids, it may exhibit behavior typical of weak acids in solution, partially dissociating to release protons.
Formula:C7H8NO2
InChI:InChI=1/C7H9NO2/c1-4-3-6(7(9)10)5(2)8-4/h3,8H,1-2H3,(H,9,10)/p-1
SMILES:Cc1cc(c(C)[nH]1)C(=O)[O-]
Synonyms:- 2,5-Dimethylpyrrole-3-carboxylic acid
- 2,5-dimethyl-1H-pyrrole-3-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,5-Dimethylpyrrole-3-carboxylic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H8NO2Purity:97%Color and Shape:Cream to pale brown, PowderMolecular weight:138.152,5-Dimethylpyrrole-3-Carboxylic Acid
CAS:Formula:C7H9NO2Purity:97%Color and Shape:SolidMolecular weight:139.15192,5-dimethyl-1H-pyrrole-3-carboxylic acid
CAS:2,5-dimethyl-1H-pyrrole-3-carboxylic acidPurity:95%Molecular weight:139.15g/mol2,5-Dimethyl-1H-pyrrole-3-carboxylic acid
CAS:Formula:C7H9NO2Purity:97%Color and Shape:SolidMolecular weight:139.154



