CAS 57344-88-4
:(3S)-3-(4-aminophenyl)-3-ethyl-piperidine-2,6-dione; 2,3-dihydroxybutanedioic acid
Description:
The chemical substance with the name "(3S)-3-(4-aminophenyl)-3-ethyl-piperidine-2,6-dione; 2,3-dihydroxybutanedioic acid" and CAS number 57344-88-4 is a compound that exhibits both piperidine and dicarboxylic acid functionalities. The piperidine ring contributes to its cyclic structure, while the presence of an amino group on the phenyl ring suggests potential for hydrogen bonding and interactions with biological targets. The dicarboxylic acid moiety, specifically 2,3-dihydroxybutanedioic acid, indicates that the compound may participate in various acid-base reactions and could serve as a chelating agent or a precursor in synthetic pathways. The stereochemistry denoted by (3S) implies a specific spatial arrangement of atoms, which can influence the compound's reactivity and biological activity. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that allow for diverse interactions in biological systems.
Formula:C17H22N2O8
InChI:InChI=1/C13H16N2O2.C4H6O6/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9;5-1(3(7)8)2(6)4(9)10/h3-6H,2,7-8,14H2,1H3,(H,15,16,17);1-2,5-6H,(H,7,8)(H,9,10)/t13-;/m0./s1
SMILES:CC[C@]1(CCC(=NC1=O)O)c1ccc(cc1)N.C(C(C(=O)O)O)(C(=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
R-(+)-Aminoglutethimide L-tartrate
CAS:Controlled Product<p>R-(+)-Aminoglutethimide is a potent inhibitor of mitochondrial electron transport and the cleavage enzyme 4-phenylimidazole. It inhibits mitochondrial ATP production by binding to the inner mitochondrial membrane and preventing the passage of electrons from cytochrome c oxidase to oxygen. This drug has been shown to be effective in treating corticotroph adenoma, a benign tumor of the anterior pituitary gland, which is due to excessive secretion of ACTH by the gland. R-(+)-Aminoglutethimide can also be used for treatment of Cushing's syndrome due to its ability to inhibit cortisol synthesis in the adrenal cortex. This drug has been shown to act as a potent inhibitor of progesterone synthesis in bovine and human ovaries, leading to decreased levels of pregnenolone, which is an important precursor for other steroid hormones such as testosterone or estrogens.</p>Formula:C17H22N2O8Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:382.37 g/mol
