CAS 57346-43-7
:5-(methoxymethyl)pyrimidine-2,4(1H,3H)-dione
Description:
5-(Methoxymethyl)pyrimidine-2,4(1H,3H)-dione, with the CAS number 57346-43-7, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a methoxymethyl group (-OCH2-CH3) at the 5-position and two carbonyl groups at the 2 and 4 positions, contributing to its diketone functionality. The presence of these functional groups imparts specific chemical reactivity, making it a potential candidate for various synthetic applications in medicinal chemistry and organic synthesis. The compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Overall, 5-(methoxymethyl)pyrimidine-2,4(1H,3H)-dione is of interest for its potential biological activity and utility in the development of pharmaceuticals.
Formula:C6H8N2O3
InChI:InChI=1/C6H8N2O3/c1-11-3-4-2-7-6(10)8-5(4)9/h2H,3H2,1H3,(H2,7,8,9,10)
SMILES:COCc1cnc(nc1O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(Methoxymethyl)-2,4(1H, 3H)-pyrimidinedione
CAS:Intermediates and Building Blocks - Nucleoside base; Heterocyclic Compounds - PyrimidineFormula:C6H8N2O3Color and Shape:SolidMolecular weight:156.14Ref: TM-TNU0845
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire
