CAS 5736-04-9: 2-methyl-1,3-dioxolane-2-carboxylic acid
Description:2-Methyl-1,3-dioxolane-2-carboxylic acid is a cyclic compound characterized by a dioxolane ring structure, which features two oxygen atoms in a five-membered ring. This compound contains a carboxylic acid functional group, contributing to its acidic properties. The presence of the methyl group at the 2-position of the dioxolane ring influences its reactivity and solubility. Typically, compounds like this exhibit moderate polarity due to the carboxylic acid and ether functionalities, allowing for hydrogen bonding and solubility in polar solvents such as water. The compound may be used in organic synthesis and could serve as an intermediate in the production of various pharmaceuticals or agrochemicals. Its stability and reactivity can be influenced by factors such as pH and temperature, and it may undergo typical reactions associated with carboxylic acids, including esterification and decarboxylation. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C5H8O4
InChI:InChI=1/C5H8O4/c1-5(4(6)7)8-2-3-9-5/h2-3H2,1H3,(H,6,7)
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-methyl-1,3-dioxolane-2-carboxylic acid REF: 10-F312942CAS: 5736-04-9 | 95.0% | To inquire | Wed 23 Apr 25 |
 | 2-Methyl-1,3-dioxolane-2-carboxylic acid REF: 3D-FM125056CAS: 5736-04-9 | Min. 95% | - - - | Discontinued product |
2-methyl-1,3-dioxolane-2-carboxylic acid
Ref: 10-F312942
| 1g | To inquire | ||
| 250mg | To inquire |
2-Methyl-1,3-dioxolane-2-carboxylic acid
Ref: 3D-FM125056
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
