CAS 57362-82-0
:methyl 1-methyl-1H-1,2,3-triazole-4-carboxylate
Description:
Methyl 1-methyl-1H-1,2,3-triazole-4-carboxylate, with the CAS number 57362-82-0, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in polar solvents. It is typically a white to off-white solid at room temperature and is known for its applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the methyl group enhances its lipophilicity, which can influence its biological activity and interaction with other molecules. Additionally, the triazole moiety is significant in medicinal chemistry due to its ability to form hydrogen bonds and participate in coordination with metal ions, making it a valuable scaffold in drug design. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C5H7N3O2
InChI:InChI=1/C5H7N3O2/c1-8-3-4(6-7-8)5(9)10-2/h3H,1-2H3
SMILES:Cn1cc(C(=O)OC)nn1
Synonyms:- 1H-1,2,3-Triazole-4-carboxylic acid, 1-methyl-, methyl ester
- Methyl 1-methyl-1H-1,2,3-triazole-4-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 1-methyl-1H-1,2,3-triazole-4-carboxylate
CAS:Formula:C5H7N3O2Purity:98%Color and Shape:SolidMolecular weight:141.1280Methyl 1-methyl-1H-1,2,3-triazole-4-carboxylate
CAS:Methyl 1-methyl-1H-1,2,3-triazole-4-carboxylatePurity:98%Molecular weight:141.13g/molMethyl 1-methyl-1H-1,2,3-triazole-4-carboxylate
CAS:Formula:C5H7N3O2Purity:98%Molecular weight:141.13Methyl 1-methyl-1H-1,2,3-triazole-4-carboxylate
CAS:<p>Methyl 1-methyl-1H-1,2,3-triazole-4-carboxylate is a chemical compound that contains two methyl groups and one carbonyl group. It is used in the production of polymers such as cellulose acetate and other commercial products. Methyl 1-methyl-1H-1,2,3-triazole-4-carboxylate has been shown to regulate the transport of molecules across cell membranes by changing their physicochemical properties. This process can be done through a number of mechanisms, including:</p>Formula:C5H7N3O2Purity:Min. 95%Molecular weight:141.13 g/mol



