CAS 573675-31-7

7-Bromo-4-chloropyrido[3,2-d]pyrimidine

Description:

7-Bromo-4-chloropyrido[3,2-d]pyrimidine is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents enhances its reactivity and potential for various applications in medicinal chemistry and material science. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, making it suitable for various synthetic processes. Its structure allows for potential interactions with biological targets, which is of interest in drug development. The compound may also display interesting electronic properties due to the halogen substituents, influencing its behavior in chemical reactions and interactions with other molecules. As with many halogenated compounds, it is essential to handle 7-Bromo-4-chloropyrido[3,2-d]pyrimidine with care, considering potential toxicity and environmental impact. Overall, its unique structural features and reactivity make it a valuable compound for research and industrial applications.

Formula: C₇H₃BrClN₃

InChI: InChI=1/C7H3BrClN3/c8-4-1-5-6(10-2-4)7(9)12-3-11-5/h1-3H

SMILES: c1c(cnc2c1ncnc2Cl)Br

7-Bromo-4-chloropyrido[3,2-d]pyrimidine

CAS: 573675-31-7

Formula: C₇H₃BrClN₃

Purity: 97%

Molecular weight: 244.4758

Ref: IN-DA00ECX5

7-Bromo-4-chloropyrido[3,2-d]pyrimidine

CAS: 573675-31-7

7-Bromo-4-chloropyrido[3,2-d]pyrimidine

Molecular weight: 244.47582g/mol

Ref: 54-OR1021914

7-Bromo-4-chloropyrido[3,2-d]pyrimidine

CAS: 573675-31-7

Formula: C₇H₃BrClN₃

Purity: 97%

Molecular weight: 244.48

Ref: 10-F321176

7-Bromo-4-chloropyrido[3,2-d]pyrimidine

CAS: 573675-31-7

Versatile small molecule scaffold

Formula: C₇H₃BrClN₃

Purity: Min. 95%

Molecular weight: 244.48 g/mol

Ref: 3D-YXA67531