CAS 5737-13-3
:4H-Cyclopenta[def]phenanthren-4-one
Description:
4H-Cyclopenta[def]phenanthren-4-one, with the CAS number 5737-13-3, is an organic compound characterized by its polycyclic aromatic structure. This compound features a fused ring system that includes a cyclopentane moiety integrated into a phenanthrene framework, which contributes to its unique chemical properties. It typically exhibits a planar structure, allowing for significant π-π stacking interactions, which can influence its solubility and reactivity. The presence of a ketone functional group at the 4-position introduces polar characteristics, affecting its interaction with solvents and other chemical species. This compound may display fluorescence properties, making it of interest in various applications, including organic electronics and photonics. Additionally, its structural features may confer biological activity, warranting investigation in medicinal chemistry. Overall, 4H-Cyclopenta[def]phenanthren-4-one is a notable compound in the realm of organic chemistry, with potential implications in materials science and pharmacology.
Formula:C15H8O
InChI:InChI=1S/C15H8O/c16-15-11-5-1-3-9-7-8-10-4-2-6-12(15)14(10)13(9)11/h1-8H
InChI key:InChIKey=IFCBMPOMNSORDG-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C4C1=CC=CC4=CC=C3C=CC2
Synonyms:- NSC 132541
- 4H-Cyclopenta[d,e,f]phenanthrene-4-one
- 4H-Cyclopenta[def]phenanthren-4-one
- 4,5-Phenanthrylene ketone
- 4H-CYCLOPENTA[DEF]PHENANTHREN-4-ONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4H-Cyclopenta[def]phenanthren-4-one
CAS:Formula:C15H8OColor and Shape:Yellow SolidMolecular weight:204.23

