CAS 57373-81-6
:1-(5-tert-butyl-2-hydroxyphenyl)ethanone
Description:
1-(5-tert-butyl-2-hydroxyphenyl)ethanone, also known as a derivative of hydroxyphenyl ketone, is an organic compound characterized by its phenolic structure and ketone functional group. It features a tert-butyl group, which enhances its hydrophobic properties, and a hydroxyl group that contributes to its potential as an antioxidant. This compound is typically a solid at room temperature and may exhibit a crystalline form. Its molecular structure allows for various applications, particularly in the fields of pharmaceuticals and materials science, where it may serve as a UV stabilizer or an intermediate in organic synthesis. The presence of the hydroxyl group can also influence its reactivity, making it a candidate for further chemical modifications. Additionally, the compound's stability and solubility characteristics can vary based on the solvent used, which is important for its practical applications. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C12H16O2
InChI:InChI=1/C12H16O2/c1-8(13)10-7-9(12(2,3)4)5-6-11(10)14/h5-7,14H,1-4H3
SMILES:CC(=O)c1cc(ccc1O)C(C)(C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-[5-(tert-Butyl)-2-hydroxyphenyl]ethan-1-one, 2-Acetyl-4-(tert-butyl)phenol
CAS:Formula:C12H16O2Purity:97%Color and Shape:SolidMolecular weight:192.25425'-(tert-Butyl)-2'-hydroxyacetophenone
CAS:<p>5'-(tert-Butyl)-2'-hydroxyacetophenone</p>Purity:97%Color and Shape:LiquidMolecular weight:192.25g/mol1-(5-tert-Butyl-2-hydroxyphenyl)ethan-1-one
CAS:<p>1-(5-tert-Butyl-2-hydroxyphenyl)ethan-1-one is a compound that can be produced by the reaction of acetates with phenols. This reaction produces an aryloxy group, which reacts with another molecule of acetate to form the acetophenones. The reaction has been shown to occur in the presence of light and heat.</p>Formula:C12H16O2Purity:Min. 95%Molecular weight:192.25 g/mol



