CAS 57378-72-0
:4,5-Dicaffeoylquinic acid
Description:
4,5-Dicaffeoylquinic acid is a polyphenolic compound belonging to the family of caffeoylquinic acids, which are esters of quinic acid and caffeic acid. This compound is characterized by its two caffeoyl groups attached to the 4 and 5 positions of the quinic acid backbone. It typically appears as a yellowish-brown solid and is soluble in polar solvents such as water and methanol. 4,5-Dicaffeoylquinic acid exhibits notable antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and neuroprotective effects. It is commonly found in various plants, particularly in coffee and certain herbs, and is studied for its role in traditional medicine and functional foods. The compound's stability and reactivity can be influenced by factors such as pH and temperature, making it an interesting subject for research in both food chemistry and pharmacology. Its presence in dietary sources has led to investigations into its potential health-promoting effects, particularly in relation to chronic diseases.
Formula:C25H24O12
InChI:InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(35,24(33)34)11-19(30)23(20)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,35H,11-12H2,(H,33,34)/t19-,20-,23+,25-/m1/s1
InChI key:InChIKey=UFCLZKMFXSILNL-GCBRTHAASA-N
SMILES:O(C(C=CC1=CC(O)=C(O)C=C1)=O)[C@@H]2[C@H](OC(C=CC3=CC(O)=C(O)C=C3)=O)C[C@](C(O)=O)(O)C[C@H]2O
Synonyms:- (1R,3R,4S,5R)-3,4-Bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,5-dihydroxycyclohexanecarboxylic acid
- (1R,3R,4S,5R)-3,4-bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,5-dihydroxycyclohexanecarboxylic acid
- 4,5-Dicaffeoylquinic acid
- Cyclohexanecarboxylic acid, 3,4-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,5-dihydroxy-, (1R,3R,4S,5R)-
- Cyclohexanecarboxylic acid, 3,4-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,5-dihydroxy-, (1R,3R,4S,5R)-
- Cyclohexanecarboxylic acid, 3,4-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,5-dihydroxy-, [1R-(1α,3α,4α,5β)]-
- Isochlorogenic acid C(4,5')
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Cyclohexanecarboxylic acid,3,4-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,5-dihydroxy-,(1R,3R,4S,5R)-
CAS:Formula:C25H24O12Purity:98%Color and Shape:SolidMolecular weight:516.45094,5-Dicaffeoylquinic acid
CAS:Formula:C25H24O12Purity:≥ 98.0%Color and Shape:Off-white to light yellow powderMolecular weight:516.454,5-Di-O-caffeoylquinic acid
CAS:Formula:C25H24O12Purity:(HPLC) ≥ 98.0%Color and Shape:Off-white to yellow powderMolecular weight:516.45Isochlorogenic acid C
CAS:Isochlorogenic acid C possesses potent hepatoprotective and anti-HBV effects; the anti-apoptotic and anti-injury effects could be achieved by its anti-oxidative properties and interfering the caspase-3 and TGF-beta expressions.;the anti-HBV target may mainly be at the downstream links of HBV replication process and is probably associated with blocking translation step.Formula:C25H24O12Purity:95%~99%Color and Shape:White powderMolecular weight:516.4554,5-Dicaffeoylquinic acid
CAS:<p>1.</p>Formula:C25H24O12Purity:98.86% - ≥95%Color and Shape:SolidMolecular weight:516.453,4-dicaffeoylquinic acid
CAS:Carboxylic acid with additional oxygen functionsFormula:C25H24O12Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:516.464,5-Dicaffeoylquinic acid
CAS:<p>4,5-Dicaffeoylquinic acid is a polyphenolic compound, which is primarily a derivative of chlorogenic acids found in various plants, notably within the Asteraceae family. It is naturally sourced from leaves, fruits, and other plant tissues where it plays a critical role in the plant's defense mechanisms. It functions through its ability to scavenge free radicals, thereby exhibiting significant antioxidant activity. This compound can inhibit oxidative stress by neutralizing reactive oxygen species (ROS), thus protecting cellular structures from damage.</p>Formula:C25H24O12Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:516.45 g/mol4,5-Dicaffeoylquinic Acid
CAS:Controlled ProductFormula:C25H24O12Color and Shape:NeatMolecular weight:516.45
![Cyclohexanecarboxylic acid,3,4-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,5-dihydroxy-,(…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2FIN%2Fthumb%2FDA00IA84.jpg&w=3840&q=75)
