CAS 57381-37-0
:2-Bromo-5-chlorobenzonitrile
Description:
2-Bromo-5-chlorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a bromine atom and a chlorine atom, as well as a cyano group (nitrile). The presence of these halogen substituents typically influences the compound's reactivity, polarity, and solubility. This compound is often used in organic synthesis and can serve as an intermediate in the production of pharmaceuticals and agrochemicals. Its molecular structure contributes to its potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the cyano group imparts certain electronic properties, making it a useful building block in the synthesis of more complex molecules. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C7H3BrClN
InChI:InChI=1S/C7H3BrClN/c8-7-2-1-6(9)3-5(7)4-10/h1-3H
InChI key:InChIKey=CTSHRMBLMKPDAG-UHFFFAOYSA-N
SMILES:C(#N)C1=C(Br)C=CC(Cl)=C1
Synonyms:- Benzonitrile, 2-bromo-5-chloro-
- 2-Bromo-5-chlorobenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-5-chlorobenzonitrile
CAS:Formula:C7H3BrClNPurity:98%Color and Shape:SolidMolecular weight:216.46242-Bromo-5-chlorobenzonitrile
CAS:2-Bromo-5-chlorobenzonitrileFormula:C7H3BrClNPurity:≥95%Color and Shape: off white powderMolecular weight:216.46g/mol2-Bromo-5-chlorobenzonitrile
CAS:Formula:C7H3BrClNPurity:95%Color and Shape:Solid, Off-white powderMolecular weight:216.462-Bromo-5-chlorobenzonitrile
CAS:<p>2-Bromo-5-chlorobenzonitrile (2BC) is a synthetic drug that has been used in the treatment of neuropsychiatric disorders. It is a glutamate receptor subtype agonist, which activates the metabotropic glutamate receptor. 2BC binds to the pyridinium site of the mGluR5 subtype, inhibiting glutamate binding and preventing activation of ion channels. The benzothiazole moiety has been found to be essential for this activity. 2BC also has antiviral properties and can inhibit HIV replication in vitro.<br>2BC is currently being explored as a potential therapeutic agent for schizophrenia and other neuropsychiatric disorders that involve glutamatergic dysfunction such as depression, bipolar disorder, and anxiety disorder.br>br><br>br>br><br>Potential side effects include sedation, dizziness, blurred vision, headache, drowsiness, fatigue, nausea/vomiting and increased appetite.</p>Formula:C7H3BrClNPurity:Min. 95%Color and Shape:PowderMolecular weight:216.46 g/mol



