CAS 57381-49-4

2-Bromo-4-chlorobenzonitrile

Description:

2-Bromo-4-chlorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a bromine atom and a chlorine atom, as well as a cyano group (nitrile). The presence of these halogen substituents contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions. This compound typically appears as a solid at room temperature and is known for its moderate solubility in organic solvents. Its molecular structure can influence its physical properties, such as melting and boiling points, which are generally higher than those of unsubstituted benzonitriles due to the electronegative halogens. 2-Bromo-4-chlorobenzonitrile is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, owing to its ability to participate in further chemical transformations. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and proper storage conditions should be maintained to ensure stability.

Formula: C₇H₃BrClN

InChI: InChI=1S/C7H3BrClN/c8-7-3-6(9)2-1-5(7)4-10/h1-3H

InChI key: InChIKey=PEAQTMSQUXACRN-UHFFFAOYSA-N

SMILES: C(#N)C1=C(Br)C=C(Cl)C=C1

Synonyms:

• Benzonitrile, 2-bromo-4-chloro-
• 2-Bromo-4-chlorobenzonitrile

2-Bromo-4-chlorobenzonitrile

CAS: 57381-49-4

Formula: C₇H₃BrClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 216.4624

Ref: IN-DA003718

2-Bromo-4-chlorobenzonitrile

CAS: 57381-49-4

2-Bromo-4-chlorobenzonitrile

Formula: C₇H₃BrClN

Purity: 98%

Color and Shape: cream solid

Molecular weight: 216.46g/mol

Ref: 54-OR46060

2-Bromo-4-chlorobenzonitrile

CAS: 57381-49-4

Formula: C₇H₃BrClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 216.46

Ref: 10-F062768