CAS 574-97-0
:1-Fluoro-2-naphthalenecarboxylic acid
Description:
1-Fluoro-2-naphthalenecarboxylic acid is an aromatic carboxylic acid characterized by the presence of a naphthalene ring substituted with a fluorine atom and a carboxylic acid group. Its molecular structure features a fluorine atom at the 1-position and a carboxylic acid functional group at the 2-position of the naphthalene ring, contributing to its unique chemical properties. This compound is typically a solid at room temperature and is known for its relatively high melting point. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water due to the hydrophobic nature of the naphthalene moiety. The presence of the fluorine atom can enhance the compound's reactivity and influence its interactions with other molecules, making it of interest in various chemical syntheses and applications. Additionally, 1-fluoro-2-naphthalenecarboxylic acid may exhibit interesting biological activities, which can be explored in medicinal chemistry and drug development.
Formula:C11H7FO2
InChI:InChI=1S/C11H7FO2/c12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h1-6H,(H,13,14)
InChI key:InChIKey=XKFQSLSAPMCGQS-UHFFFAOYSA-N
SMILES:FC=1C2=C(C=CC1C(O)=O)C=CC=C2
Synonyms:- 1-Fluoro-2-naphthalenecarboxylic acid
- 1-Fluoro-2-naphthoic acid
- 2-Naphthalenecarboxylic acid, 1-fluoro-
- 2-Naphthoic acid, 1-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Fluoronaphthalene-2-carboxylic acid
CAS:1-Fluoronaphthalene-2-carboxylic acidFormula:C11H7FO2Purity:95%Color and Shape: off white crystalline powderMolecular weight:190.17g/mol1-Fluoronaphthalene-2-carboxylic acid
CAS:1-Fluoronaphthalene-2-carboxylic acid is an organic compound with the formula CHFO. It is a white solid that is soluble in organic solvents. The methoxy group makes this compound reactive, meaning it can react with other compounds to form new compounds. 1-Fluoronaphthalene-2-carboxylic acid can be synthesized by reacting 2 equivalents of Grignard reagents with naphthalene, followed by hydrolysis of the ester group. This reaction yields a carboxylic acid with a fluorine atom attached to a carbon adjacent to the carboxyl group. 1-Fluoronaphthalene-2-carboxylic acid has been used as both an imidoester and nucleophilic reagent in organic chemistry.
Formula:C11H7FO2Purity:Min. 95%Molecular weight:190.17 g/mol


