CymitQuimica logo

CAS 57401-76-0

:

ethyl 2-aminopyrimidine-5-carboxylate

Description:
Ethyl 2-aminopyrimidine-5-carboxylate, identified by its CAS number 57401-76-0, is a chemical compound that features a pyrimidine ring substituted with an amino group and a carboxylate ester. This compound typically exhibits characteristics common to pyrimidine derivatives, including potential basicity due to the presence of the amino group, which can participate in hydrogen bonding and act as a nucleophile in various chemical reactions. The ethyl ester group contributes to its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Ethyl 2-aminopyrimidine-5-carboxylate is of interest in medicinal chemistry and drug development, as pyrimidine derivatives often exhibit diverse biological activities, including antimicrobial and anticancer properties. Its synthesis usually involves multi-step organic reactions, and it can serve as a building block for more complex molecules in pharmaceutical research. Overall, this compound's unique structure and functional groups make it a valuable subject of study in both synthetic and medicinal chemistry.
Formula:C6H7N3O2
InChI:InChI=1/C6H7N3O2/c1-11-5(10)4-2-8-6(7)9-3-4/h2-3H,1H3,(H2,7,8,9)
InChI key:GCGQBUJYXVSZBS-UHFFFAOYSA-N
SMILES:COC(=O)c1c[nH]c(=N)nc1
Synonyms:
  • 2-Aminopyrimidine-5-carboxylic acid ethyl ester
  • 2-Amino-pyrimidine-5-carboxylic acid ethyl ester
Found 4 products.