CAS 574013-66-4: Methyl (2E)-3-[3-[(cyclohexylcarbonyl)[[4′-(dimethylamino)[1,1′-biphenyl]-4-yl]methyl]amino]phenyl]-2-propenoate
Description:Methyl (2E)-3-[3-[(cyclohexylcarbonyl)[[4′-(dimethylamino)[1,1′-biphenyl]-4-yl]methyl]amino]phenyl]-2-propenoate, with the CAS number 574013-66-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a methyl ester functional group, a propenoate moiety, and multiple aromatic rings. This compound features a cyclohexylcarbonyl group, which contributes to its lipophilicity, and a dimethylamino group that may enhance its solubility in polar solvents. The presence of the biphenyl structure suggests potential applications in organic electronics or as a building block in pharmaceuticals. Its E configuration indicates a specific geometric arrangement around the double bond, which can influence its reactivity and interaction with biological targets. Overall, this compound's unique structural features may confer specific biological activities, making it of interest in medicinal chemistry and material science. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C32H36N2O3
InChI:InChI=1S/C32H36N2O3/c1-33(2)29-19-17-27(18-20-29)26-15-12-25(13-16-26)23-34(32(36)28-9-5-4-6-10-28)30-11-7-8-24(22-30)14-21-31(35)37-3/h7-8,11-22,28H,4-6,9-10,23H2,1-3H3/b21-14+
InChI key:InChIKey=VLQTUNDJHLEFEQ-KGENOOAVSA-N
SMILES:O=C(OC)C=CC1=CC=CC(=C1)N(C(=O)C2CCCCC2)CC=3C=CC(=CC3)C4=CC=C(C=C4)N(C)C
- Synonyms:
- 2-propenoic acid, 3-[3-[(cyclohexylcarbonyl)[[4'-(dimethylamino)[1,1'-biphenyl]-4-yl]methyl]amino]phenyl]-, methyl ester, (2E)-
- Fexaramine
- Methyl (2E)-3-[3-[(cyclohexylcarbonyl)[[4′-(dimethylamino)[1,1′-biphenyl]-4-yl]methyl]amino]phenyl]-2-propenoate
![Methyl (2E)-3-[3-[(cyclohexylcarbonyl)[[4′-(dimethylamino)[1,1′-biphenyl]-4-yl]methyl]amino]phenyl…](https://static.cymitquimica.com/cas-image/337613-methyl-2e-3-3-cyclohexylcarbonyl-4-dimethylamino-11-biphenyl-4-yl-methyl-amino-phenyl-2-propenoate.png)
