CAS 57402-46-7
:potassium (2Z)-4-oxopent-2-en-2-olate hydrate
Description:
Potassium (2Z)-4-oxopent-2-en-2-olate hydrate, with the CAS number 57402-46-7, is a chemical compound that features a potassium cation associated with an anionic species derived from a pentenone structure. This compound typically exists as a hydrate, indicating the presence of water molecules in its crystalline form. The structure includes a conjugated system with a carbonyl group and an enolate, which contributes to its reactivity and potential applications in organic synthesis. The presence of the potassium ion suggests that it may exhibit properties typical of alkali metal salts, such as solubility in polar solvents and the ability to participate in ionic interactions. The compound may be utilized in various chemical reactions, including those involving nucleophilic attack due to the enolate character. Additionally, its hydrate form implies that it can interact with moisture, which may influence its stability and handling. Overall, this compound represents an interesting example of a potassium salt with potential utility in synthetic organic chemistry.
Formula:C5H9KO3
InChI:InChI=1/C5H8O2.K.H2O/c1-4(6)3-5(2)7;;/h3,6H,1-2H3;;1H2/q;+1;/p-1/b4-3-;;
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
