CAS 57410-31-8
:[2-(1,2,3-benzothiadiazol-5-yl)-7-chloro-4-oxo-1,2,3,4-tetrahydrophthalazin-1-yl]acetic acid
Description:
The chemical substance known as [2-(1,2,3-benzothiadiazol-5-yl)-7-chloro-4-oxo-1,2,3,4-tetrahydrophthalazin-1-yl]acetic acid, with the CAS number 57410-31-8, is characterized by its complex molecular structure that includes a benzothiadiazole moiety and a tetrahydrophthalazine framework. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of the acetic acid functional group. It may demonstrate biological activity, potentially serving as a pharmacophore in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The presence of chlorine and the unique heterocyclic structures may contribute to its reactivity and interaction with biological systems. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, this substance is of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.
Formula:C16H11ClN4O3S
InChI:InChI=1/C16H11ClN4O3S/c17-8-1-3-10-11(5-8)13(7-15(22)23)21(19-16(10)24)9-2-4-14-12(6-9)18-20-25-14/h1-6,13H,7H2,(H,19,24)(H,22,23)
Synonyms:- 1-Phthalazineacetic acid, 2-(1,2,3-benzothiadiazol-5-yl)-7-chloro-1,2,3,4-tetrahydro-4-oxo-
- BTS 39542
- 2-(1,2,3-Benzothiadiazol-5-yl)-7-chloro-1,2,3,4-tetrahydro-4-oxo-1-phthalazineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Bts 39542
CAS:Bts 39542 is a diuretic that plays a major role in the Henle circulation and increases renal blood flow without affecting glomerular filtration rate.Formula:C16H11ClN4O3SColor and Shape:SolidMolecular weight:374.8
