CAS 57414-76-3

(3-amino-2-methyl-phenyl)-dideuterio-methanol

Description:

(3-amino-2-methyl-phenyl)-dideuterio-methanol, with the CAS number 57414-76-3, is a chemical compound characterized by its specific molecular structure, which includes an amino group and a methyl group attached to a phenyl ring. The presence of deuterium, a stable isotope of hydrogen, indicates that this compound is a labeled version of methanol, where hydrogen atoms are replaced by deuterium. This substitution can influence the compound's physical and chemical properties, such as its boiling point and reactivity. The amino group contributes to the compound's potential as a base and its ability to participate in hydrogen bonding, which can affect solubility in various solvents. Additionally, the methyl group can influence steric hindrance and electronic effects within the molecule. Overall, this compound may be of interest in various fields, including medicinal chemistry and isotopic labeling studies, due to its unique properties and potential applications in research.

Formula: C₈H₉D₂NO

InChI: InChI=1/C8H11NO/c1-6-7(5-10)3-2-4-8(6)9/h2-4,10H,5,9H2,1H3/i5D2

SMILES: Cc1c(cccc1N)C(O)([2H])[2H]

3-Amino-2-methyl-benzyl-d2 Alcohol

Controlled Product

CAS: 57414-76-3

Applications 3-Amino-2-methyl-benzyl-d2 Alcohol (cas# 57414-76-3) is a compound useful in organic synthesis.

Formula: C₈₂H₂H₉NO

Color and Shape: Neat

Molecular weight: 139.19

Ref: TR-A614357