CAS 57414-85-4
:ethyl 3-amino-2-methylbenzoate
Description:
Ethyl 3-amino-2-methylbenzoate, with the CAS number 57414-85-4, is an organic compound that belongs to the class of benzoate esters. It features a benzoic acid derivative where an ethyl group is esterified to the carboxylic acid, and an amino group is positioned at the meta position relative to the ester group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is characterized by its aromatic structure, which contributes to its chemical stability and potential reactivity. Ethyl 3-amino-2-methylbenzoate may exhibit moderate solubility in organic solvents, while its solubility in water is generally limited due to the hydrophobic nature of the aromatic ring. The presence of the amino group can impart basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and usage guidelines.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-3-13-10(12)8-5-4-6-9(11)7(8)2/h4-6H,3,11H2,1-2H3
SMILES:CCOC(=O)c1cccc(c1C)N
Synonyms:- Benzoic Acid, 3-Amino-2-Methyl-, Ethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 3-Amino-2-methylbenzoate
CAS:Formula:C10H13NO2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:179.22Ethyl 3-amino-2-methylbenzoate
CAS:Formula:C10H13NO2Purity:98%Color and Shape:SolidMolecular weight:179.2157Ethyl 3-amino-2-methylbenzoate
CAS:Ethyl 3-amino-2-methylbenzoateFormula:C10H13NO2Purity:≥95%Color and Shape: clear. very dark red/brown liquidMolecular weight:179.22g/molEthyl 3-amino-2-methylbenzoate
CAS:Formula:C10H13NO2Purity:98%Color and Shape:Liquid, No data available.Molecular weight:179.219



