CAS 57423-71-9

Physalin F

Description:

Physalin F is a natural compound classified as a steroidal saponin, primarily derived from the plant Physalis angulata, commonly known as the cutleaf groundcherry. This compound exhibits a range of biological activities, including anti-inflammatory, antiviral, and anticancer properties, making it of interest in pharmacological research. Physalin F is characterized by its complex molecular structure, which includes a steroid backbone and various functional groups that contribute to its bioactivity. The compound is typically studied for its potential therapeutic applications, particularly in the context of cancer treatment, where it has shown promise in inhibiting tumor growth and inducing apoptosis in cancer cells. Additionally, Physalin F's mechanism of action may involve modulation of signaling pathways and interaction with cellular receptors. As a natural product, it is also of interest in the field of natural product chemistry and drug discovery, highlighting the importance of plant-derived compounds in developing new therapeutic agents.

Formula: C₂₈H₃₀O₁₀

InChI: InChI=1S/C28H30O10/c1-22-10-17-24(3)28-18(22)19(30)27(38-28,34-11-14(22)20(31)35-17)13-9-16-26(36-16)7-4-5-15(29)23(26,2)12(13)6-8-25(28,33)21(32)37-24/h4-5,12-14,16-18,33H,6-11H2,1-3H3/t12-,13+,14-,16+,17+,18-,22+,23-,24-,25-,26+,27+,28-/m0/s1

InChI key: InChIKey=VSLWNSSUMFSGFF-IFSNGKJOSA-N

SMILES: C[C@]12[C@]34[C@@]5([C@@]6(C)[C@@](CO[C@](O3)(C5=O)[C@]7([C@](CC[C@]4(O)C(=O)O1)([C@]8(C)[C@]9([C@@](C7)(O9)[H])CC=CC8=O)[H])[H])(C(=O)O[C@@]2(C6)[H])[H])[H]

Synonyms:

• 16,24-Cyclo-13,14-secoergost-2-ene-18,26-dioic acid, 5,6:14,17:14,27-triepoxy-13,20,22-trihydroxy-1,15-dioxo-, γ-lactone δ-lactone, (5β,6β,14α,16β,22α,25S)-
• Physalin F
• 14H-17,3-(Epoxymethano)-1,17:2,6-dimethanooxireno[4,4a]naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,15aH)-tetrone, 2,3,6,6a,9,10,10a,10b,16,16a-decahydro-8a-hydroxy-2,6a,10b-trimethyl-, [1S-(1α,2β,3α,6β,6aα,8aβ,10aα,10bβ,14aR,15aα,16aβ,17α,18aS*)]-
• 14H-17,3-(Epoxymethano)-1,17:2,6-dimethanooxireno[4,4a]naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone, 2,3,6,6a,9,10,10a,15a,16,16a-decahydro-8a-hydroxy-2,6a,10b-trimethyl-, (1S,2S,3S,6R,6aS,8aR,10aS,10bR,14aS,15aR,16aR,17R,18aR)-
• (1S,2S,3S,6R,6aS,8aR,10aS,10bR,14aS,15aR,16aR,17R,18aR)-2,3,6,6a,9,10,10a,15a,16,16a-Decahydro-8a-hydroxy-2,6a,10b-trimethyl-14H-17,3-(epoxymethano)-1,17:2,6-dimethanooxireno[4,4a]naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone

physalin F

CAS: 57423-71-9

physalin F

Purity: ≥98%

Molecular weight: 526.53g/mol

Ref: 54-BUP07609

Physalin F

CAS: 57423-71-9

Formula: C₂₈H₃₀O₁₀

Molecular weight: 526.54

Ref: 7W-GY4539

Physalin F

CAS: 57423-71-9

Formula: C₂₈H₃₀O₁₀

Purity: 95%~99%

Molecular weight: 526.538

Ref: BP-BP4291

physalin F

CAS: 57423-71-9

Physalin F is a natural blocker of CaV2.3 (R-type) and CaV2.2 (N-type) voltage-gated calcium channels.Cost-effective and quality-assured.

Formula: C₂₈H₃₀O₁₀

Purity: 99.5% - 99.61%

Color and Shape: Solid

Molecular weight: 526.53

Ref: TM-T8716

Physalin F

CAS: 57423-71-9

Physalin F is a chemical compound, which is a type of withanolide primarily sourced from the Physalis genus, particularly from the calyx of Physalis angulata. It functions through a complex mode of action that includes modulation of immune responses and apoptotic induction. This activity is largely attributed to its ability to interfere with various molecular pathways, including but not limited to the NF-κB signaling pathway, which plays a crucial role in regulating immune response, cell proliferation, and apoptosis.

Formula: C₂₈H₃₀O₁₀

Purity: Min. 95%

Molecular weight: 526.5 g/mol

Ref: 3D-HCA42371