CymitQuimica logo

CAS 5744-80-9

:

3-Bromo-1,5-dimethyl-1H-pyrazole

Description:
3-Bromo-1,5-dimethyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 3-position and two methyl groups at the 1 and 5 positions contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the bromine atom, which can be replaced by various nucleophiles. Additionally, 3-bromo-1,5-dimethyl-1H-pyrazole may exhibit biological activity, making it of interest in medicinal chemistry and agrochemical applications. Its solubility in organic solvents and limited solubility in water are typical for halogenated pyrazoles. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound serves as a versatile intermediate in organic synthesis and research.
Formula:C5H7BrN2
InChI:InChI=1S/C5H7BrN2/c1-4-3-5(6)7-8(4)2/h3H,1-2H3
InChI key:InChIKey=NELVNOMSYNLQGQ-UHFFFAOYSA-N
SMILES:CC=1N(C)N=C(Br)C1
Synonyms:
  • 1H-pyrazole, 3-bromo-1,5-dimethyl-
  • 3-Bromo-1,5-dimethyl-1H-pyrazole
  • Pyrazole, 3-bromo-1,5-dimethyl-
  • 3-Bromo-1,5-dimethylpyrazole
Found 4 products.